C23H22N2O3 — CID 164695838
1'-(1H-indole-4-carbonyl)spiro[3H-chromene-2,4'-azepane]-4-one (PubChem CID 164695838) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 1'-(1H-indole-4-carbonyl)spiro[3H-chromene-2,4'-azepane]-4-one.
| Compound Name | 1'-(1H-indole-4-carbonyl)spiro[3H-chromene-2,4'-azepane]-4-one |
|---|---|
| PubChem CID | 164695838 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 1'-(1H-indole-4-carbonyl)spiro[3H-chromene-2,4'-azepane]-4-one |
| SMILES | O=C1CC2(CCCN(C(=O)c3cccc4[nH]ccc34)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C23H22N2O3/c26-20-15-23(28-21-8-2-1-5-18(20)21)10-4-13-25(14-11-23)22(27)17-6-3-7-19-16(17)9-12-24-19/h1-3,5-9,12,24H,4,10-11,13-15H2 |
| InChIKey | GRMNCEYYFBFMAO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |