C26H34N2O3S — CID 108759473
(E)-N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 108759473) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is (E)-N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108759473 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | (E)-N-[2-[4-(azepan-1-ylsulfonyl)phenyl]ethyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(/C=C/C(=O)NCCc2ccc(S(=O)(=O)N3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C26H34N2O3S/c1-21(2)24-12-7-22(8-13-24)11-16-26(29)27-18-17-23-9-14-25(15-10-23)32(30,31)28-19-5-3-4-6-20-28/h7-16,21H,3-6,17-20H2,1-2H3,(H,27,29)/b16-11+ |
| InChIKey | VKZNHIDBTUDFCW-LFIBNONCSA-N |
| XLogP | 4.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|