C20H27NO — CID 1221490
(E)-N-[2-(cyclohexen-1-yl)ethyl]-3-(4-propan-2-ylphenyl)prop-2-enamide (PubChem CID 1221490) has the molecular formula C20H27NO and a molecular weight of 297.44 g/mol. Its IUPAC name is (E)-N-[2-(cyclohexen-1-yl)ethyl]-3-(4-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(cyclohexen-1-yl)ethyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1221490 |
| Molecular Formula | C20H27NO |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | (E)-N-[2-(cyclohexen-1-yl)ethyl]-3-(4-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1ccc(/C=C/C(=O)NCCC2=CCCCC2)cc1 |
| InChI | InChI=1S/C20H27NO/c1-16(2)19-11-8-18(9-12-19)10-13-20(22)21-15-14-17-6-4-3-5-7-17/h6,8-13,16H,3-5,7,14-15H2,1-2H3,(H,21,22)/b13-10+ |
| InChIKey | YXWSTVFSUJGQGA-JLHYYAGUSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|