C17H21NOS — CID 3668106
N-[2-(cyclohexen-1-yl)ethyl]-3-phenylsulfanylprop-2-enamide (PubChem CID 3668106) has the molecular formula C17H21NOS and a molecular weight of 287.43 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-phenylsulfanylprop-2-enamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-phenylsulfanylprop-2-enamide |
|---|---|
| PubChem CID | 3668106 |
| Molecular Formula | C17H21NOS |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-phenylsulfanylprop-2-enamide |
| SMILES | O=C(C=CSc1ccccc1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C17H21NOS/c19-17(12-14-20-16-9-5-2-6-10-16)18-13-11-15-7-3-1-4-8-15/h2,5-7,9-10,12,14H,1,3-4,8,11,13H2,(H,18,19) |
| InChIKey | FHQDDCKUWMIHFE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|