C18H20N2O4S — CID 108760130
[2-methoxy-4-[(E)-3-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]-3-oxoprop-1-enyl]phenyl] acetate (PubChem CID 108760130) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is [2-methoxy-4-[(E)-3-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]-3-oxoprop-1-enyl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(E)-3-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]-3-oxoprop-1-enyl]phenyl] acetate |
|---|---|
| PubChem CID | 108760130 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | [2-methoxy-4-[(E)-3-[1-(2-methyl-1,3-thiazol-4-yl)ethylamino]-3-oxoprop-1-enyl]phenyl] acetate |
| SMILES | COc1cc(/C=C/C(=O)NC(C)c2csc(C)n2)ccc1OC(C)=O |
| InChI | InChI=1S/C18H20N2O4S/c1-11(15-10-25-12(2)20-15)19-18(22)8-6-14-5-7-16(24-13(3)21)17(9-14)23-4/h5-11H,1-4H3,(H,19,22)/b8-6+ |
| InChIKey | SURTXHCJLGWXKB-SOFGYWHQSA-N |
| XLogP | 3.28 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|