C43H52O6Si — CID 10876215
(2R,4aR,6R,8S,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-8-phenylmethoxy-6-(3-phenylmethoxypropyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one (PubChem CID 10876215) has the molecular formula C43H52O6Si and a molecular weight of 692.97 g/mol. Its IUPAC name is (2R,4aR,6R,8S,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-8-phenylmethoxy-6-(3-phenylmethoxypropyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one.
| Compound Name | (2R,4aR,6R,8S,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-8-phenylmethoxy-6-(3-phenylmethoxypropyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one |
|---|---|
| PubChem CID | 10876215 |
| Molecular Formula | C43H52O6Si |
| Molecular Weight | 692.97 g/mol |
| Exact Mass | 692.35 |
| IUPAC Name | (2R,4aR,6R,8S,8aS)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-8-phenylmethoxy-6-(3-phenylmethoxypropyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-b]pyran-3-one |
| SMILES | CC(C)(C)[Si](OC[C@@]1(C)O[C@H]2[C@@H](OCc3ccccc3)C[C@@H](CCCOCc3ccccc3)O[C@@H]2CC1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C43H52O6Si/c1-42(2,3)50(36-23-13-7-14-24-36,37-25-15-8-16-26-37)47-32-43(4)40(44)29-39-41(49-43)38(46-31-34-20-11-6-12-21-34)28-35(48-39)22-17-27-45-30-33-18-9-5-10-19-33/h5-16,18-21,23-26,35,38-39,41H,17,22,27-32H2,1-4H3/t35-,38+,39-,41+,43-/m1/s1 |
| InChIKey | DVCNFJUTFOHWJT-XORPYMGDSA-N |
| XLogP | 7.42 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.97 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|