C24H27BrN4O2 — CID 108764018
4-(2-bromo-4-ethylphenoxy)-1-(4-quinoxalin-2-ylpiperazin-1-yl)butan-1-one (PubChem CID 108764018) has the molecular formula C24H27BrN4O2 and a molecular weight of 483.41 g/mol. Its IUPAC name is 4-(2-bromo-4-ethylphenoxy)-1-(4-quinoxalin-2-ylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-(2-bromo-4-ethylphenoxy)-1-(4-quinoxalin-2-ylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 108764018 |
| Molecular Formula | C24H27BrN4O2 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | 4-(2-bromo-4-ethylphenoxy)-1-(4-quinoxalin-2-ylpiperazin-1-yl)butan-1-one |
| SMILES | CCc1ccc(OCCCC(=O)N2CCN(c3cnc4ccccc4n3)CC2)c(Br)c1 |
| InChI | InChI=1S/C24H27BrN4O2/c1-2-18-9-10-22(19(25)16-18)31-15-5-8-24(30)29-13-11-28(12-14-29)23-17-26-20-6-3-4-7-21(20)27-23/h3-4,6-7,9-10,16-17H,2,5,8,11-15H2,1H3 |
| InChIKey | IDSXVPWQZUDIST-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|