C24H24N2O2 — CID 108767339
(E)-3-(4-ethoxyphenyl)-N-[2-(4-methylanilino)phenyl]prop-2-enamide (PubChem CID 108767339) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-N-[2-(4-methylanilino)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-N-[2-(4-methylanilino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 108767339 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-N-[2-(4-methylanilino)phenyl]prop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2ccccc2Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H24N2O2/c1-3-28-21-15-10-19(11-16-21)12-17-24(27)26-23-7-5-4-6-22(23)25-20-13-8-18(2)9-14-20/h4-17,25H,3H2,1-2H3,(H,26,27)/b17-12+ |
| InChIKey | MYIUBCCCTXNSKR-SFQUDFHCSA-N |
| XLogP | 5.79 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|