C21H19NO2 — CID 804776
(E)-3-(4-ethoxyphenyl)-N-naphthalen-1-ylprop-2-enamide (PubChem CID 804776) has the molecular formula C21H19NO2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (E)-3-(4-ethoxyphenyl)-N-naphthalen-1-ylprop-2-enamide.
| Compound Name | (E)-3-(4-ethoxyphenyl)-N-naphthalen-1-ylprop-2-enamide |
|---|---|
| PubChem CID | 804776 |
| Molecular Formula | C21H19NO2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | (E)-3-(4-ethoxyphenyl)-N-naphthalen-1-ylprop-2-enamide |
| SMILES | CCOc1ccc(/C=C/C(=O)Nc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C21H19NO2/c1-2-24-18-13-10-16(11-14-18)12-15-21(23)22-20-9-5-7-17-6-3-4-8-19(17)20/h3-15H,2H2,1H3,(H,22,23)/b15-12+ |
| InChIKey | CELHJCHGOLRYGG-NTCAYCPXSA-N |
| XLogP | 4.89 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|