C16H16ClN3O2S — CID 108768265
1-benzyl-N-[4-(chloromethyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 108768265) has the molecular formula C16H16ClN3O2S and a molecular weight of 349.84 g/mol. Its IUPAC name is 1-benzyl-N-[4-(chloromethyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-benzyl-N-[4-(chloromethyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108768265 |
| Molecular Formula | C16H16ClN3O2S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-benzyl-N-[4-(chloromethyl)-1,3-thiazol-2-yl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nc(CCl)cs1)C1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C16H16ClN3O2S/c17-7-13-10-23-16(18-13)19-15(22)12-6-14(21)20(9-12)8-11-4-2-1-3-5-11/h1-5,10,12H,6-9H2,(H,18,19,22) |
| InChIKey | SVGOWVGTVAFZMS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|