C19H17N3O2S — CID 8882783
(3R)-N-(1,3-benzothiazol-2-yl)-1-benzyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 8882783) has the molecular formula C19H17N3O2S and a molecular weight of 351.43 g/mol. Its IUPAC name is (3R)-N-(1,3-benzothiazol-2-yl)-1-benzyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-(1,3-benzothiazol-2-yl)-1-benzyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 8882783 |
| Molecular Formula | C19H17N3O2S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | (3R)-N-(1,3-benzothiazol-2-yl)-1-benzyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)[C@@H]1CC(=O)N(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H17N3O2S/c23-17-10-14(12-22(17)11-13-6-2-1-3-7-13)18(24)21-19-20-15-8-4-5-9-16(15)25-19/h1-9,14H,10-12H2,(H,20,21,24)/t14-/m1/s1 |
| InChIKey | BIGPJLHEZKJSRI-CQSZACIVSA-N |
| XLogP | 3.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |