C16H19N3O2S — CID 17082469
N-(1,3-benzothiazol-2-yl)-1-butyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 17082469) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-1-butyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-1-butyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17082469 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-1-butyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCCN1CC(C(=O)Nc2nc3ccccc3s2)CC1=O |
| InChI | InChI=1S/C16H19N3O2S/c1-2-3-8-19-10-11(9-14(19)20)15(21)18-16-17-12-6-4-5-7-13(12)22-16/h4-7,11H,2-3,8-10H2,1H3,(H,17,18,21) |
| InChIKey | AQDSKFMRLXNSLB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |