C21H21ClN4O2 — CID 108768336
5-[(4-chlorobenzoyl)amino]-N,N-diethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 108768336) has the molecular formula C21H21ClN4O2 and a molecular weight of 396.88 g/mol. Its IUPAC name is 5-[(4-chlorobenzoyl)amino]-N,N-diethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-[(4-chlorobenzoyl)amino]-N,N-diethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108768336 |
| Molecular Formula | C21H21ClN4O2 |
| Molecular Weight | 396.88 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 5-[(4-chlorobenzoyl)amino]-N,N-diethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cnn(-c2ccccc2)c1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H21ClN4O2/c1-3-25(4-2)21(28)18-14-23-26(17-8-6-5-7-9-17)19(18)24-20(27)15-10-12-16(22)13-11-15/h5-14H,3-4H2,1-2H3,(H,24,27) |
| InChIKey | ZUVMAMQVMZULEM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.88 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |