C24H26Cl2N4O3 — CID 108746038
5-[4-(2,4-dichlorophenoxy)butanoylamino]-N,N-diethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 108746038) has the molecular formula C24H26Cl2N4O3 and a molecular weight of 489.40 g/mol. Its IUPAC name is 5-[4-(2,4-dichlorophenoxy)butanoylamino]-N,N-diethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-[4-(2,4-dichlorophenoxy)butanoylamino]-N,N-diethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108746038 |
| Molecular Formula | C24H26Cl2N4O3 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 5-[4-(2,4-dichlorophenoxy)butanoylamino]-N,N-diethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cnn(-c2ccccc2)c1NC(=O)CCCOc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H26Cl2N4O3/c1-3-29(4-2)24(32)19-16-27-30(18-9-6-5-7-10-18)23(19)28-22(31)11-8-14-33-21-13-12-17(25)15-20(21)26/h5-7,9-10,12-13,15-16H,3-4,8,11,14H2,1-2H3,(H,28,31) |
| InChIKey | DHNKQMHCABJIJF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|