C22H22FN5O2 — CID 108768464
N'-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-N-(4-fluorophenyl)butanediamide (PubChem CID 108768464) has the molecular formula C22H22FN5O2 and a molecular weight of 407.45 g/mol. Its IUPAC name is N'-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-N-(4-fluorophenyl)butanediamide.
| Compound Name | N'-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-N-(4-fluorophenyl)butanediamide |
|---|---|
| PubChem CID | 108768464 |
| Molecular Formula | C22H22FN5O2 |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | N'-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-N-(4-fluorophenyl)butanediamide |
| SMILES | Cc1cc(C)nc(Nc2cccc(NC(=O)CCC(=O)Nc3ccc(F)cc3)c2)n1 |
| InChI | InChI=1S/C22H22FN5O2/c1-14-12-15(2)25-22(24-14)28-19-5-3-4-18(13-19)27-21(30)11-10-20(29)26-17-8-6-16(23)7-9-17/h3-9,12-13H,10-11H2,1-2H3,(H,26,29)(H,27,30)(H,24,25,28) |
| InChIKey | YAGIZFNLQFOECH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |