C24H28N4O2 — CID 108768513
N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-4-(4-ethylphenoxy)butanamide (PubChem CID 108768513) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-4-(4-ethylphenoxy)butanamide.
| Compound Name | N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-4-(4-ethylphenoxy)butanamide |
|---|---|
| PubChem CID | 108768513 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | N-[3-[(4,6-dimethylpyrimidin-2-yl)amino]phenyl]-4-(4-ethylphenoxy)butanamide |
| SMILES | CCc1ccc(OCCCC(=O)Nc2cccc(Nc3nc(C)cc(C)n3)c2)cc1 |
| InChI | InChI=1S/C24H28N4O2/c1-4-19-10-12-22(13-11-19)30-14-6-9-23(29)27-20-7-5-8-21(16-20)28-24-25-17(2)15-18(3)26-24/h5,7-8,10-13,15-16H,4,6,9,14H2,1-3H3,(H,27,29)(H,25,26,28) |
| InChIKey | DYPKEXXLCSQYIM-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|