C16H20N4O2 — CID 30131742
N'-(4,6-dimethylpyrimidin-2-yl)-4-phenoxybutanehydrazide (PubChem CID 30131742) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-4-phenoxybutanehydrazide.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-4-phenoxybutanehydrazide |
|---|---|
| PubChem CID | 30131742 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-4-phenoxybutanehydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)CCCOc2ccccc2)n1 |
| InChI | InChI=1S/C16H20N4O2/c1-12-11-13(2)18-16(17-12)20-19-15(21)9-6-10-22-14-7-4-3-5-8-14/h3-5,7-8,11H,6,9-10H2,1-2H3,(H,19,21)(H,17,18,20) |
| InChIKey | RIYGEURYLKHWMD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|