C14H16N4O3 — CID 87015407
2-(2-phenoxyethoxy)-N'-pyrimidin-2-ylacetohydrazide (PubChem CID 87015407) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-(2-phenoxyethoxy)-N'-pyrimidin-2-ylacetohydrazide.
| Compound Name | 2-(2-phenoxyethoxy)-N'-pyrimidin-2-ylacetohydrazide |
|---|---|
| PubChem CID | 87015407 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 2-(2-phenoxyethoxy)-N'-pyrimidin-2-ylacetohydrazide |
| SMILES | O=C(COCCOc1ccccc1)NNc1ncccn1 |
| InChI | InChI=1S/C14H16N4O3/c19-13(17-18-14-15-7-4-8-16-14)11-20-9-10-21-12-5-2-1-3-6-12/h1-8H,9-11H2,(H,17,19)(H,15,16,18) |
| InChIKey | KVLOEGPEADFNHM-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|