C26H22N4O5 — CID 108769134
ethyl 5-[[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]-1-quinolin-2-ylpyrazole-4-carboxylate (PubChem CID 108769134) has the molecular formula C26H22N4O5 and a molecular weight of 470.49 g/mol. Its IUPAC name is ethyl 5-[[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]-1-quinolin-2-ylpyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]-1-quinolin-2-ylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108769134 |
| Molecular Formula | C26H22N4O5 |
| Molecular Weight | 470.49 g/mol |
| Exact Mass | 470.16 |
| IUPAC Name | ethyl 5-[[(Z)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoyl]amino]-1-quinolin-2-ylpyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccc3ccccc3n2)c1NC(=O)/C=C\c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C26H22N4O5/c1-2-33-26(32)19-16-27-30(23-11-9-18-5-3-4-6-20(18)28-23)25(19)29-24(31)12-8-17-7-10-21-22(15-17)35-14-13-34-21/h3-12,15-16H,2,13-14H2,1H3,(H,29,31)/b12-8- |
| InChIKey | DZOJSWASMNMFSV-WQLSENKSSA-N |
| XLogP | 4.02 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|