C24H25N3O6 — CID 108761416
ethyl 1-phenyl-5-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]pyrazole-4-carboxylate (PubChem CID 108761416) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is ethyl 1-phenyl-5-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-phenyl-5-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108761416 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | ethyl 1-phenyl-5-[[(E)-3-(3,4,5-trimethoxyphenyl)prop-2-enoyl]amino]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1NC(=O)/C=C/c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H25N3O6/c1-5-33-24(29)18-15-25-27(17-9-7-6-8-10-17)23(18)26-21(28)12-11-16-13-19(30-2)22(32-4)20(14-16)31-3/h6-15H,5H2,1-4H3,(H,26,28)/b12-11+ |
| InChIKey | SANSIPWPSNGHJB-VAWYXSNFSA-N |
| XLogP | 3.73 |
| TPSA | 100.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|