C21H22N4O4 — CID 108769033
ethyl 5-[[(E)-but-2-enoyl]amino]-1-(8-methoxy-4-methylquinolin-2-yl)pyrazole-4-carboxylate (PubChem CID 108769033) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is ethyl 5-[[(E)-but-2-enoyl]amino]-1-(8-methoxy-4-methylquinolin-2-yl)pyrazole-4-carboxylate.
| Compound Name | ethyl 5-[[(E)-but-2-enoyl]amino]-1-(8-methoxy-4-methylquinolin-2-yl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 108769033 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | ethyl 5-[[(E)-but-2-enoyl]amino]-1-(8-methoxy-4-methylquinolin-2-yl)pyrazole-4-carboxylate |
| SMILES | C/C=C/C(=O)Nc1c(C(=O)OCC)cnn1-c1cc(C)c2cccc(OC)c2n1 |
| InChI | InChI=1S/C21H22N4O4/c1-5-8-18(26)24-20-15(21(27)29-6-2)12-22-25(20)17-11-13(3)14-9-7-10-16(28-4)19(14)23-17/h5,7-12H,6H2,1-4H3,(H,24,26)/b8-5+ |
| InChIKey | IGYAWHVBCFDCIU-VMPITWQZSA-N |
| XLogP | 3.43 |
| TPSA | 95.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|