C25H24N4O6 — CID 108771690
5,7-dimethoxy-1'-[6-(3-nitrophenyl)pyridazin-3-yl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108771690) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is 5,7-dimethoxy-1'-[6-(3-nitrophenyl)pyridazin-3-yl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 5,7-dimethoxy-1'-[6-(3-nitrophenyl)pyridazin-3-yl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108771690 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 5,7-dimethoxy-1'-[6-(3-nitrophenyl)pyridazin-3-yl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1cc(OC)c2c(c1)OC1(CCN(c3ccc(-c4cccc([N+](=O)[O-])c4)nn3)CC1)CC2=O |
| InChI | InChI=1S/C25H24N4O6/c1-33-18-13-21(34-2)24-20(30)15-25(35-22(24)14-18)8-10-28(11-9-25)23-7-6-19(26-27-23)16-4-3-5-17(12-16)29(31)32/h3-7,12-14H,8-11,15H2,1-2H3 |
| InChIKey | XBZSBDZZIOLHRP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 116.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|