C7H7FO2 — CID 10877212
(1S,5R,6R)-5-fluoro-5-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 10877212) has the molecular formula C7H7FO2 and a molecular weight of 142.13 g/mol. Its IUPAC name is (1S,5R,6R)-5-fluoro-5-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6R)-5-fluoro-5-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 10877212 |
| Molecular Formula | C7H7FO2 |
| Molecular Weight | 142.13 g/mol |
| Exact Mass | 142.04 |
| IUPAC Name | (1S,5R,6R)-5-fluoro-5-methyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | C[C@@]1(F)C=CC(=O)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C7H7FO2/c1-7(8)3-2-4(9)5-6(7)10-5/h2-3,5-6H,1H3/t5-,6-,7-/m1/s1 |
| InChIKey | LMWKZQHSOAXLFE-FSDSQADBSA-N |
| XLogP | 0.62 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.13 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|