C8H10O2 — CID 130027563
5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 130027563) has the molecular formula C8H10O2 and a molecular weight of 138.17 g/mol. Its IUPAC name is 5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | 5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 130027563 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | 5,5-dimethyl-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC1(C)C=CC(=O)C2OC21 |
| InChI | InChI=1S/C8H10O2/c1-8(2)4-3-5(9)6-7(8)10-6/h3-4,6-7H,1-2H3 |
| InChIKey | FUNVGDIBWCPCMU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|