C13H10N6S2 — CID 108772214
N-(5-methyl-1,3,4-thiadiazol-2-yl)-6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine (PubChem CID 108772214) has the molecular formula C13H10N6S2 and a molecular weight of 314.40 g/mol. Its IUPAC name is N-(5-methyl-1,3,4-thiadiazol-2-yl)-6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine.
| Compound Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine |
|---|---|
| PubChem CID | 108772214 |
| Molecular Formula | C13H10N6S2 |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | N-(5-methyl-1,3,4-thiadiazol-2-yl)-6-phenyl-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-amine |
| SMILES | Cc1nnc(Nc2nc3scc(-c4ccccc4)n3n2)s1 |
| InChI | InChI=1S/C13H10N6S2/c1-8-16-17-12(21-8)14-11-15-13-19(18-11)10(7-20-13)9-5-3-2-4-6-9/h2-7H,1H3,(H,14,17,18) |
| InChIKey | DFOIZQRHOIEMNV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |