C22H25N7O2S — CID 108772783
2-cyclohexyl-5-[4-[6-(3-nitrophenyl)pyridazin-3-yl]piperazin-1-yl]-1,3,4-thiadiazole (PubChem CID 108772783) has the molecular formula C22H25N7O2S and a molecular weight of 451.56 g/mol. Its IUPAC name is 2-cyclohexyl-5-[4-[6-(3-nitrophenyl)pyridazin-3-yl]piperazin-1-yl]-1,3,4-thiadiazole.
| Compound Name | 2-cyclohexyl-5-[4-[6-(3-nitrophenyl)pyridazin-3-yl]piperazin-1-yl]-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 108772783 |
| Molecular Formula | C22H25N7O2S |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 2-cyclohexyl-5-[4-[6-(3-nitrophenyl)pyridazin-3-yl]piperazin-1-yl]-1,3,4-thiadiazole |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc(N3CCN(c4nnc(C5CCCCC5)s4)CC3)nn2)c1 |
| InChI | InChI=1S/C22H25N7O2S/c30-29(31)18-8-4-7-17(15-18)19-9-10-20(24-23-19)27-11-13-28(14-12-27)22-26-25-21(32-22)16-5-2-1-3-6-16/h4,7-10,15-16H,1-3,5-6,11-14H2 |
| InChIKey | BARMYLYCIWRDSG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|