C22H16ClN5O3 — CID 108777512
3-(4-chlorophenyl)-6-[6-(3-nitrophenyl)pyridazin-3-yl]-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridine (PubChem CID 108777512) has the molecular formula C22H16ClN5O3 and a molecular weight of 433.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-[6-(3-nitrophenyl)pyridazin-3-yl]-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridine.
| Compound Name | 3-(4-chlorophenyl)-6-[6-(3-nitrophenyl)pyridazin-3-yl]-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridine |
|---|---|
| PubChem CID | 108777512 |
| Molecular Formula | C22H16ClN5O3 |
| Molecular Weight | 433.86 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 3-(4-chlorophenyl)-6-[6-(3-nitrophenyl)pyridazin-3-yl]-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridine |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc(N3CCc4c(noc4-c4ccc(Cl)cc4)C3)nn2)c1 |
| InChI | InChI=1S/C22H16ClN5O3/c23-16-6-4-14(5-7-16)22-18-10-11-27(13-20(18)26-31-22)21-9-8-19(24-25-21)15-2-1-3-17(12-15)28(29)30/h1-9,12H,10-11,13H2 |
| InChIKey | IMRKUNWFROVLGB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 98.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.86 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|