C22H15ClN4O6 — CID 108743420
2-[2-[3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione (PubChem CID 108743420) has the molecular formula C22H15ClN4O6 and a molecular weight of 466.84 g/mol. Its IUPAC name is 2-[2-[3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[2-[3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 108743420 |
| Molecular Formula | C22H15ClN4O6 |
| Molecular Weight | 466.84 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 2-[2-[3-(4-chlorophenyl)-5,7-dihydro-4H-[1,2]oxazolo[3,4-c]pyridin-6-yl]-2-oxoethyl]-4-nitroisoindole-1,3-dione |
| SMILES | O=C(CN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)N1CCc2c(noc2-c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C22H15ClN4O6/c23-13-6-4-12(5-7-13)20-14-8-9-25(10-16(14)24-33-20)18(28)11-26-21(29)15-2-1-3-17(27(31)32)19(15)22(26)30/h1-7H,8-11H2 |
| InChIKey | IGJFGVKFVPDTDB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 126.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.84 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|