C24H20ClN5O5 — CID 108725827
2-[4-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-4-oxobutyl]-4-nitroisoindole-1,3-dione (PubChem CID 108725827) has the molecular formula C24H20ClN5O5 and a molecular weight of 493.91 g/mol. Its IUPAC name is 2-[4-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-4-oxobutyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[4-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-4-oxobutyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 108725827 |
| Molecular Formula | C24H20ClN5O5 |
| Molecular Weight | 493.91 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | 2-[4-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-4-oxobutyl]-4-nitroisoindole-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)N1CCc2[nH]nc(-c3cccc(Cl)c3)c2C1 |
| InChI | InChI=1S/C24H20ClN5O5/c25-15-5-1-4-14(12-15)22-17-13-28(11-9-18(17)26-27-22)20(31)8-3-10-29-23(32)16-6-2-7-19(30(34)35)21(16)24(29)33/h1-2,4-7,12H,3,8-11,13H2,(H,26,27) |
| InChIKey | HQRVXERWDUTQIN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 129.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.91 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|