C16H16ClN3O2 — CID 108725865
prop-2-enyl 3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate (PubChem CID 108725865) has the molecular formula C16H16ClN3O2 and a molecular weight of 317.78 g/mol. Its IUPAC name is prop-2-enyl 3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate.
| Compound Name | prop-2-enyl 3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 108725865 |
| Molecular Formula | C16H16ClN3O2 |
| Molecular Weight | 317.78 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | prop-2-enyl 3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxylate |
| SMILES | C=CCOC(=O)N1CCc2[nH]nc(-c3cccc(Cl)c3)c2C1 |
| InChI | InChI=1S/C16H16ClN3O2/c1-2-8-22-16(21)20-7-6-14-13(10-20)15(19-18-14)11-4-3-5-12(17)9-11/h2-5,9H,1,6-8,10H2,(H,18,19) |
| InChIKey | RGEHDBNVMFYAHI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.78 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|