C14H11Cl4N3O — CID 108725831
2,2,2-trichloro-1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone (PubChem CID 108725831) has the molecular formula C14H11Cl4N3O and a molecular weight of 379.07 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
|---|---|
| PubChem CID | 108725831 |
| Molecular Formula | C14H11Cl4N3O |
| Molecular Weight | 379.07 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | 2,2,2-trichloro-1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]ethanone |
| SMILES | O=C(N1CCc2[nH]nc(-c3cccc(Cl)c3)c2C1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H11Cl4N3O/c15-9-3-1-2-8(6-9)12-10-7-21(13(22)14(16,17)18)5-4-11(10)19-20-12/h1-3,6H,4-5,7H2,(H,19,20) |
| InChIKey | GYXPXJGGPSVCBK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.07 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|