C21H17Cl3N4O2 — CID 108750017
2,4-dichloro-N-[2-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-oxoethyl]benzamide (PubChem CID 108750017) has the molecular formula C21H17Cl3N4O2 and a molecular weight of 463.75 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-oxoethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 108750017 |
| Molecular Formula | C21H17Cl3N4O2 |
| Molecular Weight | 463.75 g/mol |
| Exact Mass | 462.04 |
| IUPAC Name | 2,4-dichloro-N-[2-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-oxoethyl]benzamide |
| SMILES | O=C(NCC(=O)N1CCc2[nH]nc(-c3cccc(Cl)c3)c2C1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H17Cl3N4O2/c22-13-3-1-2-12(8-13)20-16-11-28(7-6-18(16)26-27-20)19(29)10-25-21(30)15-5-4-14(23)9-17(15)24/h1-5,8-9H,6-7,10-11H2,(H,25,30)(H,26,27) |
| InChIKey | XVGOLIRKLRVHCU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.75 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |