C16H17ClN4S — CID 108780228
3-(3-chlorophenyl)-N-prop-2-enyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbothioamide (PubChem CID 108780228) has the molecular formula C16H17ClN4S and a molecular weight of 332.86 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-N-prop-2-enyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbothioamide.
| Compound Name | 3-(3-chlorophenyl)-N-prop-2-enyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 108780228 |
| Molecular Formula | C16H17ClN4S |
| Molecular Weight | 332.86 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 3-(3-chlorophenyl)-N-prop-2-enyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carbothioamide |
| SMILES | C=CCNC(=S)N1CCc2[nH]nc(-c3cccc(Cl)c3)c2C1 |
| InChI | InChI=1S/C16H17ClN4S/c1-2-7-18-16(22)21-8-6-14-13(10-21)15(20-19-14)11-4-3-5-12(17)9-11/h2-5,9H,1,6-8,10H2,(H,18,22)(H,19,20) |
| InChIKey | MVOCTWSELAJOQZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.86 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|