C20H17ClN4O4 — CID 108725892
1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2-nitrophenoxy)ethanone (PubChem CID 108725892) has the molecular formula C20H17ClN4O4 and a molecular weight of 412.83 g/mol. Its IUPAC name is 1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2-nitrophenoxy)ethanone.
| Compound Name | 1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 108725892 |
| Molecular Formula | C20H17ClN4O4 |
| Molecular Weight | 412.83 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 1-[3-(3-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-2-(2-nitrophenoxy)ethanone |
| SMILES | O=C(COc1ccccc1[N+](=O)[O-])N1CCc2[nH]nc(-c3cccc(Cl)c3)c2C1 |
| InChI | InChI=1S/C20H17ClN4O4/c21-14-5-3-4-13(10-14)20-15-11-24(9-8-16(15)22-23-20)19(26)12-29-18-7-2-1-6-17(18)25(27)28/h1-7,10H,8-9,11-12H2,(H,22,23) |
| InChIKey | AGPNUXLNNJNMJF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.83 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|