C15H12ClN3O2S — CID 108773602
ethyl 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]pyridine-4-carboxylate (PubChem CID 108773602) has the molecular formula C15H12ClN3O2S and a molecular weight of 333.80 g/mol. Its IUPAC name is ethyl 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]pyridine-4-carboxylate.
| Compound Name | ethyl 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 108773602 |
| Molecular Formula | C15H12ClN3O2S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | ethyl 2-[(6-chloro-1,3-benzothiazol-2-yl)amino]pyridine-4-carboxylate |
| SMILES | CCOC(=O)c1ccnc(Nc2nc3ccc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C15H12ClN3O2S/c1-2-21-14(20)9-5-6-17-13(7-9)19-15-18-11-4-3-10(16)8-12(11)22-15/h3-8H,2H2,1H3,(H,17,18,19) |
| InChIKey | WCEWXEUELUVRPS-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |