C11H8ClN5S — CID 114052440
4-N-(6-chloro-1,3-benzothiazol-2-yl)pyrimidine-2,4-diamine (PubChem CID 114052440) has the molecular formula C11H8ClN5S and a molecular weight of 277.74 g/mol. Its IUPAC name is 4-N-(6-chloro-1,3-benzothiazol-2-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(6-chloro-1,3-benzothiazol-2-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 114052440 |
| Molecular Formula | C11H8ClN5S |
| Molecular Weight | 277.74 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 4-N-(6-chloro-1,3-benzothiazol-2-yl)pyrimidine-2,4-diamine |
| SMILES | Nc1nccc(Nc2nc3ccc(Cl)cc3s2)n1 |
| InChI | InChI=1S/C11H8ClN5S/c12-6-1-2-7-8(5-6)18-11(15-7)17-9-3-4-14-10(13)16-9/h1-5H,(H3,13,14,15,16,17) |
| InChIKey | GIYDJHXRUUINPV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.74 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |