C18H20N4O4 — CID 108773676
trans-(1S,2R)-2-[[[6-(3-nitrophenyl)pyridazin-3-yl]amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 108773676) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is trans-(1S,2R)-2-[[[6-(3-nitrophenyl)pyridazin-3-yl]amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | trans-(1S,2R)-2-[[[6-(3-nitrophenyl)pyridazin-3-yl]amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 108773676 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | trans-(1S,2R)-2-[[[6-(3-nitrophenyl)pyridazin-3-yl]amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCCC[C@H]1CNc1ccc(-c2cccc([N+](=O)[O-])c2)nn1 |
| InChI | InChI=1S/C18H20N4O4/c23-18(24)15-7-2-1-4-13(15)11-19-17-9-8-16(20-21-17)12-5-3-6-14(10-12)22(25)26/h3,5-6,8-10,13,15H,1-2,4,7,11H2,(H,19,21)(H,23,24)/t13-,15-/m0/s1 |
| InChIKey | KFKBRQMFXACXOK-ZFWWWQNUSA-N |
| XLogP | 3.35 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|