C10H16O2 — CID 10877518
3-[(1S)-1-prop-2-enoxyethyl]penta-1,4-dien-3-ol (PubChem CID 10877518) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-[(1S)-1-prop-2-enoxyethyl]penta-1,4-dien-3-ol.
| Compound Name | 3-[(1S)-1-prop-2-enoxyethyl]penta-1,4-dien-3-ol |
|---|---|
| PubChem CID | 10877518 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 3-[(1S)-1-prop-2-enoxyethyl]penta-1,4-dien-3-ol |
| SMILES | C=CCO[C@@H](C)C(O)(C=C)C=C |
| InChI | InChI=1S/C10H16O2/c1-5-8-12-9(4)10(11,6-2)7-3/h5-7,9,11H,1-3,8H2,4H3/t9-/m0/s1 |
| InChIKey | AFKGUKICNGQMRN-VIFPVBQESA-N |
| XLogP | 1.68 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|