C16H12ClN3O2 — CID 108778334
3-[[(3-chloroquinoxalin-2-yl)amino]methyl]benzoic acid (PubChem CID 108778334) has the molecular formula C16H12ClN3O2 and a molecular weight of 313.74 g/mol. Its IUPAC name is 3-[[(3-chloroquinoxalin-2-yl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(3-chloroquinoxalin-2-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 108778334 |
| Molecular Formula | C16H12ClN3O2 |
| Molecular Weight | 313.74 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 3-[[(3-chloroquinoxalin-2-yl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNc2nc3ccccc3nc2Cl)c1 |
| InChI | InChI=1S/C16H12ClN3O2/c17-14-15(20-13-7-2-1-6-12(13)19-14)18-9-10-4-3-5-11(8-10)16(21)22/h1-8H,9H2,(H,18,20)(H,21,22) |
| InChIKey | OWCSEKOOPKSWAY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.74 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |