C11H10N4O4 — CID 60893712
3-[[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]methyl]benzoic acid (PubChem CID 60893712) has the molecular formula C11H10N4O4 and a molecular weight of 262.23 g/mol. Its IUPAC name is 3-[[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 60893712 |
| Molecular Formula | C11H10N4O4 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 3-[[(3,5-dioxo-2H-1,2,4-triazin-6-yl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNc2n[nH]c(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C11H10N4O4/c16-9-8(14-15-11(19)13-9)12-5-6-2-1-3-7(4-6)10(17)18/h1-4H,5H2,(H,12,14)(H,17,18)(H2,13,15,16,19) |
| InChIKey | YVRMRCNHQBOXDS-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |