C26H23N3O2 — CID 175326524
3-[[[4-[4-(cyclopenten-1-yl)phenyl]-1H-indazol-3-yl]amino]methyl]benzoic acid (PubChem CID 175326524) has the molecular formula C26H23N3O2 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-[[[4-[4-(cyclopenten-1-yl)phenyl]-1H-indazol-3-yl]amino]methyl]benzoic acid.
| Compound Name | 3-[[[4-[4-(cyclopenten-1-yl)phenyl]-1H-indazol-3-yl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 175326524 |
| Molecular Formula | C26H23N3O2 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | 3-[[[4-[4-(cyclopenten-1-yl)phenyl]-1H-indazol-3-yl]amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNc2n[nH]c3cccc(-c4ccc(C5=CCCC5)cc4)c23)c1 |
| InChI | InChI=1S/C26H23N3O2/c30-26(31)21-8-3-5-17(15-21)16-27-25-24-22(9-4-10-23(24)28-29-25)20-13-11-19(12-14-20)18-6-1-2-7-18/h3-6,8-15H,1-2,7,16H2,(H,30,31)(H2,27,28,29) |
| InChIKey | RUBWYRSHFBHQQJ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |