C18H17N3O2 — CID 69422030
3-[3-[(cyclopropylamino)methyl]phenyl]-1H-indazole-5-carboxylic acid (PubChem CID 69422030) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is 3-[3-[(cyclopropylamino)methyl]phenyl]-1H-indazole-5-carboxylic acid.
| Compound Name | 3-[3-[(cyclopropylamino)methyl]phenyl]-1H-indazole-5-carboxylic acid |
|---|---|
| PubChem CID | 69422030 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 3-[3-[(cyclopropylamino)methyl]phenyl]-1H-indazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2[nH]nc(-c3cccc(CNC4CC4)c3)c2c1 |
| InChI | InChI=1S/C18H17N3O2/c22-18(23)13-4-7-16-15(9-13)17(21-20-16)12-3-1-2-11(8-12)10-19-14-5-6-14/h1-4,7-9,14,19H,5-6,10H2,(H,20,21)(H,22,23) |
| InChIKey | MVYYMOKMGHIOKZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |