C20H22N4OS — CID 166274928
[4-[[3-(1H-pyrazol-5-yl)phenyl]methylamino]piperidin-1-yl]-thiophen-2-ylmethanone (PubChem CID 166274928) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is [4-[[3-(1H-pyrazol-5-yl)phenyl]methylamino]piperidin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-[[3-(1H-pyrazol-5-yl)phenyl]methylamino]piperidin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 166274928 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [4-[[3-(1H-pyrazol-5-yl)phenyl]methylamino]piperidin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCC(NCc2cccc(-c3ccn[nH]3)c2)CC1 |
| InChI | InChI=1S/C20H22N4OS/c25-20(19-5-2-12-26-19)24-10-7-17(8-11-24)21-14-15-3-1-4-16(13-15)18-6-9-22-23-18/h1-6,9,12-13,17,21H,7-8,10-11,14H2,(H,22,23) |
| InChIKey | IOAMNLYJDLUECZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |