C20H15N3O3 — CID 123253179
3-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid (PubChem CID 123253179) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 3-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid.
| Compound Name | 3-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 123253179 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-[[(6-oxo-5H-benzo[c][1,8]naphthyridin-9-yl)amino]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CNc2ccc3c(=O)[nH]c4ncccc4c3c2)c1 |
| InChI | InChI=1S/C20H15N3O3/c24-19-16-7-6-14(10-17(16)15-5-2-8-21-18(15)23-19)22-11-12-3-1-4-13(9-12)20(25)26/h1-10,22H,11H2,(H,25,26)(H,21,23,24) |
| InChIKey | PCUDKAXRXDWJKB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|