C21H19N3O — CID 58168355
9-[benzyl(ethyl)amino]-5H-benzo[c][1,8]naphthyridin-6-one (PubChem CID 58168355) has the molecular formula C21H19N3O and a molecular weight of 329.40 g/mol. Its IUPAC name is 9-[benzyl(ethyl)amino]-5H-benzo[c][1,8]naphthyridin-6-one.
| Compound Name | 9-[benzyl(ethyl)amino]-5H-benzo[c][1,8]naphthyridin-6-one |
|---|---|
| PubChem CID | 58168355 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 9-[benzyl(ethyl)amino]-5H-benzo[c][1,8]naphthyridin-6-one |
| SMILES | CCN(Cc1ccccc1)c1ccc2c(=O)[nH]c3ncccc3c2c1 |
| InChI | InChI=1S/C21H19N3O/c1-2-24(14-15-7-4-3-5-8-15)16-10-11-18-19(13-16)17-9-6-12-22-20(17)23-21(18)25/h3-13H,2,14H2,1H3,(H,22,23,25) |
| InChIKey | HIEHXROMVRGNHG-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|