C23H27N3O4S — CID 108781202
2-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-4,8-dimethylquinoline (PubChem CID 108781202) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 2-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-4,8-dimethylquinoline.
| Compound Name | 2-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-4,8-dimethylquinoline |
|---|---|
| PubChem CID | 108781202 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 2-[4-(3,4-dimethoxyphenyl)sulfonylpiperazin-1-yl]-4,8-dimethylquinoline |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(c3cc(C)c4cccc(C)c4n3)CC2)cc1OC |
| InChI | InChI=1S/C23H27N3O4S/c1-16-6-5-7-19-17(2)14-22(24-23(16)19)25-10-12-26(13-11-25)31(27,28)18-8-9-20(29-3)21(15-18)30-4/h5-9,14-15H,10-13H2,1-4H3 |
| InChIKey | JZDYCFQKGYQLER-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |