C12H16N4O3S2 — CID 108781539
4-ethoxy-N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)benzenesulfonamide (PubChem CID 108781539) has the molecular formula C12H16N4O3S2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-ethoxy-N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)benzenesulfonamide.
| Compound Name | 4-ethoxy-N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 108781539 |
| Molecular Formula | C12H16N4O3S2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-ethoxy-N-(3-ethylsulfanyl-1H-1,2,4-triazol-5-yl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2nc(SCC)n[nH]2)cc1 |
| InChI | InChI=1S/C12H16N4O3S2/c1-3-19-9-5-7-10(8-6-9)21(17,18)16-11-13-12(15-14-11)20-4-2/h5-8H,3-4H2,1-2H3,(H2,13,14,15,16) |
| InChIKey | HHUXMFPLZXYVSM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |