C21H29N5O2 — CID 108783809
5-(cyclohexylcarbamoylamino)-N,N-diethyl-1-phenylpyrazole-4-carboxamide (PubChem CID 108783809) has the molecular formula C21H29N5O2 and a molecular weight of 383.50 g/mol. Its IUPAC name is 5-(cyclohexylcarbamoylamino)-N,N-diethyl-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-(cyclohexylcarbamoylamino)-N,N-diethyl-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108783809 |
| Molecular Formula | C21H29N5O2 |
| Molecular Weight | 383.50 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | 5-(cyclohexylcarbamoylamino)-N,N-diethyl-1-phenylpyrazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1cnn(-c2ccccc2)c1NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C21H29N5O2/c1-3-25(4-2)20(27)18-15-22-26(17-13-9-6-10-14-17)19(18)24-21(28)23-16-11-7-5-8-12-16/h6,9-10,13-16H,3-5,7-8,11-12H2,1-2H3,(H2,23,24,28) |
| InChIKey | QOMBZGDICKFMBP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |