C23H25FN2O2S — CID 108788224
2-(4-fluorophenyl)-N-(4-hexoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 108788224) has the molecular formula C23H25FN2O2S and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(4-hexoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-(4-hexoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 108788224 |
| Molecular Formula | C23H25FN2O2S |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(4-hexoxyphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCCCOc1ccc(NC(=O)c2sc(-c3ccc(F)cc3)nc2C)cc1 |
| InChI | InChI=1S/C23H25FN2O2S/c1-3-4-5-6-15-28-20-13-11-19(12-14-20)26-22(27)21-16(2)25-23(29-21)17-7-9-18(24)10-8-17/h7-14H,3-6,15H2,1-2H3,(H,26,27) |
| InChIKey | ZLFWAAMEDBNGKH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|