C21H21FN2O4S — CID 55624281
2-(4-fluorophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 55624281) has the molecular formula C21H21FN2O4S and a molecular weight of 416.47 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 55624281 |
| Molecular Formula | C21H21FN2O4S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[4-methoxy-3-(2-methoxyethoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | COCCOc1cc(NC(=O)c2sc(-c3ccc(F)cc3)nc2C)ccc1OC |
| InChI | InChI=1S/C21H21FN2O4S/c1-13-19(29-21(23-13)14-4-6-15(22)7-5-14)20(25)24-16-8-9-17(27-3)18(12-16)28-11-10-26-2/h4-9,12H,10-11H2,1-3H3,(H,24,25) |
| InChIKey | QPHSPMRMXUBQKU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|